2-Aminobenzylamine dihydrochloride
2-Aminomethylphenylamine dihydrochloride
CAS: 29483-71-4
Molecular Formula: C7H12Cl2N2
2-Aminobenzylamine dihydrochloride - Names and Identifiers
| Name | 2-Aminomethylphenylamine dihydrochloride |
| Synonyms | oaMinobenzylaMine O-AMINOBENZYLAMINE 2HCL 2-Aminobenzylamine dihydrochloride o-Aminobenzylamine dihydrochloride o-Aminobenzylamine dihydrochloride 2-Ammoniomethyl-anilinium-dichlorid 2-(aminomethyl)aniline dihydrochloride 2-Aminomethylphenylamine dihydrochloride 2-Aminomethyl-phenylamine dihydrochloride |
| CAS | 29483-71-4 |
| InChI | InChI=1/C7H10N2.2ClH/c8-5-6-3-1-2-4-7(6)9;;/h1-4H,5,8-9H2;2*1H |
2-Aminobenzylamine dihydrochloride - Physico-chemical Properties
| Molecular Formula | C7H12Cl2N2 |
| Molar Mass | 195.08958 |
| Boling Point | 327.3°C at 760 mmHg |
| Flash Point | 151.7°C |
| Vapor Presure | 0.000148mmHg at 25°C |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
2-Aminobenzylamine dihydrochloride - Introduction
2-Aminomethylphenylamine dihydrochloride, chemical formula C8H12N2 · 2HCl, is an organic compound. The following is a description of the properties, uses, preparation and safety information of the compound:
Nature:
-Appearance: 2-Aminomethylphenylamine dihydrochloride is white crystal or crystalline powder.
-Solubility: Soluble in water, but less soluble in organic solvents.
-Melting point: The melting point of this compound is about 190-195°C.
Use:
2-Aminomethylphenylamine dihydrochloride has certain application value in the field of medicine, and its main uses include:
-Pharmaceutical research: as a pharmaceutical intermediate for the synthesis of other organic compounds.
-Dye research: It can be used to synthesize dyes and dye precursors.
Method:
The synthesis of 2-Aminomethylphenylamine dihydrochloride can be carried out mainly through the following steps:
1. React O-aminobenzylamine with hydrochloric acid to generate O-aminobenzylamine hydrochloride.
2. Dissolve O-aminobenzylamine hydrochloride in water.
3. Excess hydrochloric acid was added, and excess Amine was added dropwise to react with O-aminobenzylamine hydrochloride.
4. The precipitate was filtered and dried to give 2-Aminomethylphenylamine dihydrochloride.
Safety Information:
The specific safety of 2-Aminomethylphenylamine dihydrochloride requires specific analysis of specific circumstances, but the following safety information is generally used as a reference:
-Avoid inhaling dust and contact with skin or eyes.
-Wear appropriate personal protective equipment during use, such as chemical protective glasses and gloves.
-Avoid reacting with strong oxidants.
-Experiment or operate in a well-ventilated place.
-Please refer to the relevant safety data sheet (MSDS) for more detailed safety information.
Nature:
-Appearance: 2-Aminomethylphenylamine dihydrochloride is white crystal or crystalline powder.
-Solubility: Soluble in water, but less soluble in organic solvents.
-Melting point: The melting point of this compound is about 190-195°C.
Use:
2-Aminomethylphenylamine dihydrochloride has certain application value in the field of medicine, and its main uses include:
-Pharmaceutical research: as a pharmaceutical intermediate for the synthesis of other organic compounds.
-Dye research: It can be used to synthesize dyes and dye precursors.
Method:
The synthesis of 2-Aminomethylphenylamine dihydrochloride can be carried out mainly through the following steps:
1. React O-aminobenzylamine with hydrochloric acid to generate O-aminobenzylamine hydrochloride.
2. Dissolve O-aminobenzylamine hydrochloride in water.
3. Excess hydrochloric acid was added, and excess Amine was added dropwise to react with O-aminobenzylamine hydrochloride.
4. The precipitate was filtered and dried to give 2-Aminomethylphenylamine dihydrochloride.
Safety Information:
The specific safety of 2-Aminomethylphenylamine dihydrochloride requires specific analysis of specific circumstances, but the following safety information is generally used as a reference:
-Avoid inhaling dust and contact with skin or eyes.
-Wear appropriate personal protective equipment during use, such as chemical protective glasses and gloves.
-Avoid reacting with strong oxidants.
-Experiment or operate in a well-ventilated place.
-Please refer to the relevant safety data sheet (MSDS) for more detailed safety information.
Last Update：2024-04-09 02:00:44
Supplier List
Product Name: O-AMINOBENZYLAMINE 2HCL Visit Supplier Webpage Request for quotation
CAS: 29483-71-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 29483-71-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: O-AMINOBENZYLAMINE 2HCL Visit Supplier Webpage Request for quotation
CAS: 29483-71-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 29483-71-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History